C15H25N3O4S — CID 119994383
3,5-dimethoxy-N-(3-piperazin-1-ylpropyl)benzenesulfonamide (PubChem CID 119994383) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(3-piperazin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 3,5-dimethoxy-N-(3-piperazin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119994383 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3,5-dimethoxy-N-(3-piperazin-1-ylpropyl)benzenesulfonamide |
| SMILES | COc1cc(OC)cc(S(=O)(=O)NCCCN2CCNCC2)c1 |
| InChI | InChI=1S/C15H25N3O4S/c1-21-13-10-14(22-2)12-15(11-13)23(19,20)17-4-3-7-18-8-5-16-6-9-18/h10-12,16-17H,3-9H2,1-2H3 |
| InChIKey | BOCCLAKYTSNUCK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|