C15H25N3O3S — CID 119994792
1-(3-methoxyphenyl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide (PubChem CID 119994792) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide.
| Compound Name | 1-(3-methoxyphenyl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide |
|---|---|
| PubChem CID | 119994792 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-(3-methoxyphenyl)-N-(3-piperazin-1-ylpropyl)methanesulfonamide |
| SMILES | COc1cccc(CS(=O)(=O)NCCCN2CCNCC2)c1 |
| InChI | InChI=1S/C15H25N3O3S/c1-21-15-5-2-4-14(12-15)13-22(19,20)17-6-3-9-18-10-7-16-8-11-18/h2,4-5,12,16-17H,3,6-11,13H2,1H3 |
| InChIKey | NJRKWPPLRXEGFC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|