C14H23Cl2FN4O5S — CID 120706451
3-fluoro-4-methoxy-5-nitro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide;dihydrochloride (PubChem CID 120706451) has the molecular formula C14H23Cl2FN4O5S and a molecular weight of 449.33 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-5-nitro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide;dihydrochloride.
| Compound Name | 3-fluoro-4-methoxy-5-nitro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 120706451 |
| Molecular Formula | C14H23Cl2FN4O5S |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 3-fluoro-4-methoxy-5-nitro-N-(3-piperazin-1-ylpropyl)benzenesulfonamide;dihydrochloride |
| SMILES | COc1c(F)cc(S(=O)(=O)NCCCN2CCNCC2)cc1[N+](=O)[O-].Cl.Cl |
| InChI | InChI=1S/C14H21FN4O5S.2ClH/c1-24-14-12(15)9-11(10-13(14)19(20)21)25(22,23)17-3-2-6-18-7-4-16-5-8-18;;/h9-10,16-17H,2-8H2,1H3;2*1H |
| InChIKey | SVIXTMHJLHWIFF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|