C13H19ClFN3O5S — CID 120707908
3-fluoro-4-methoxy-5-nitro-N-(piperidin-3-ylmethyl)benzenesulfonamide;hydrochloride (PubChem CID 120707908) has the molecular formula C13H19ClFN3O5S and a molecular weight of 383.83 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-5-nitro-N-(piperidin-3-ylmethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 3-fluoro-4-methoxy-5-nitro-N-(piperidin-3-ylmethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120707908 |
| Molecular Formula | C13H19ClFN3O5S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-fluoro-4-methoxy-5-nitro-N-(piperidin-3-ylmethyl)benzenesulfonamide;hydrochloride |
| SMILES | COc1c(F)cc(S(=O)(=O)NCC2CCCNC2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H18FN3O5S.ClH/c1-22-13-11(14)5-10(6-12(13)17(18)19)23(20,21)16-8-9-3-2-4-15-7-9;/h5-6,9,15-16H,2-4,7-8H2,1H3;1H |
| InChIKey | XTJJSOHCGCQKTB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|