C16H25ClFN3O5S — CID 120711382
N-[2-(cycloheptylamino)ethyl]-3-fluoro-4-methoxy-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120711382) has the molecular formula C16H25ClFN3O5S and a molecular weight of 425.91 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-fluoro-4-methoxy-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-fluoro-4-methoxy-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120711382 |
| Molecular Formula | C16H25ClFN3O5S |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-fluoro-4-methoxy-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | COc1c(F)cc(S(=O)(=O)NCCNC2CCCCCC2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C16H24FN3O5S.ClH/c1-25-16-14(17)10-13(11-15(16)20(21)22)26(23,24)19-9-8-18-12-6-4-2-3-5-7-12;/h10-12,18-19H,2-9H2,1H3;1H |
| InChIKey | ZIOQVYWOQDJYTA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|