C15H20ClN3O6S — CID 54004449
4-chloro-3-[2-(cyclohexylamino)ethylsulfamoyl]-5-nitrobenzoic acid (PubChem CID 54004449) has the molecular formula C15H20ClN3O6S and a molecular weight of 405.86 g/mol. Its IUPAC name is 4-chloro-3-[2-(cyclohexylamino)ethylsulfamoyl]-5-nitrobenzoic acid.
| Compound Name | 4-chloro-3-[2-(cyclohexylamino)ethylsulfamoyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 54004449 |
| Molecular Formula | C15H20ClN3O6S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 4-chloro-3-[2-(cyclohexylamino)ethylsulfamoyl]-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(Cl)c(S(=O)(=O)NCCNC2CCCCC2)c1 |
| InChI | InChI=1S/C15H20ClN3O6S/c16-14-12(19(22)23)8-10(15(20)21)9-13(14)26(24,25)18-7-6-17-11-4-2-1-3-5-11/h8-9,11,17-18H,1-7H2,(H,20,21) |
| InChIKey | KNVUQQBTYHTWTN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|