C15H22FN3O4S — CID 119987233
N-[2-(cycloheptylamino)ethyl]-2-fluoro-6-nitrobenzenesulfonamide (PubChem CID 119987233) has the molecular formula C15H22FN3O4S and a molecular weight of 359.42 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-fluoro-6-nitrobenzenesulfonamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-fluoro-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119987233 |
| Molecular Formula | C15H22FN3O4S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-fluoro-6-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(F)c1S(=O)(=O)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C15H22FN3O4S/c16-13-8-5-9-14(19(20)21)15(13)24(22,23)18-11-10-17-12-6-3-1-2-4-7-12/h5,8-9,12,17-18H,1-4,6-7,10-11H2 |
| InChIKey | PRJROCKCHQFWQZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|