C12H17ClFN3O4S — CID 120723462
2-fluoro-6-nitro-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120723462) has the molecular formula C12H17ClFN3O4S and a molecular weight of 353.80 g/mol. Its IUPAC name is 2-fluoro-6-nitro-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 2-fluoro-6-nitro-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120723462 |
| Molecular Formula | C12H17ClFN3O4S |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-fluoro-6-nitro-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccc(F)c1S(=O)(=O)NCC[C@H]1CCCN1 |
| InChI | InChI=1S/C12H16FN3O4S.ClH/c13-10-4-1-5-11(16(17)18)12(10)21(19,20)15-8-6-9-3-2-7-14-9;/h1,4-5,9,14-15H,2-3,6-8H2;1H/t9-;/m1./s1 |
| InChIKey | RCFVVTGJAYKKFL-SBSPUUFOSA-N |
| XLogP | 1.58 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|