C12H16FN3O4S — CID 104972697
2-fluoro-5-nitro-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]benzenesulfonamide (PubChem CID 104972697) has the molecular formula C12H16FN3O4S and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-fluoro-5-nitro-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]benzenesulfonamide.
| Compound Name | 2-fluoro-5-nitro-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104972697 |
| Molecular Formula | C12H16FN3O4S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-fluoro-5-nitro-N-[2-[(2S)-pyrrolidin-2-yl]ethyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(F)c(S(=O)(=O)NCC[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C12H16FN3O4S/c13-11-4-3-10(16(17)18)8-12(11)21(19,20)15-7-5-9-2-1-6-14-9/h3-4,8-9,14-15H,1-2,5-7H2/t9-/m0/s1 |
| InChIKey | ZJKMGWFOOJFPPP-VIFPVBQESA-N |
| XLogP | 1.15 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|