C15H23FN2O2S — CID 2093654
N-[3-(cyclohexylamino)propyl]-2-fluorobenzenesulfonamide (PubChem CID 2093654) has the molecular formula C15H23FN2O2S and a molecular weight of 314.43 g/mol. Its IUPAC name is N-[3-(cyclohexylamino)propyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[3-(cyclohexylamino)propyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 2093654 |
| Molecular Formula | C15H23FN2O2S |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-[3-(cyclohexylamino)propyl]-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCNC1CCCCC1)c1ccccc1F |
| InChI | InChI=1S/C15H23FN2O2S/c16-14-9-4-5-10-15(14)21(19,20)18-12-6-11-17-13-7-2-1-3-8-13/h4-5,9-10,13,17-18H,1-3,6-8,11-12H2 |
| InChIKey | ICULMLQXRVPFBU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|