C13H17FN2O4S — CID 79177684
4-[3-(cyclopropylamino)propylsulfamoyl]-3-fluorobenzoic acid (PubChem CID 79177684) has the molecular formula C13H17FN2O4S and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-[3-(cyclopropylamino)propylsulfamoyl]-3-fluorobenzoic acid.
| Compound Name | 4-[3-(cyclopropylamino)propylsulfamoyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 79177684 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-[3-(cyclopropylamino)propylsulfamoyl]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCCCNC2CC2)c(F)c1 |
| InChI | InChI=1S/C13H17FN2O4S/c14-11-8-9(13(17)18)2-5-12(11)21(19,20)16-7-1-6-15-10-3-4-10/h2,5,8,10,15-16H,1,3-4,6-7H2,(H,17,18) |
| InChIKey | VMASXSCPHJUNRY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|