C13H17FN2O5S — CID 154741645
3-fluoro-4-(2-morpholin-4-ylethylsulfamoyl)benzoic acid (PubChem CID 154741645) has the molecular formula C13H17FN2O5S and a molecular weight of 332.35 g/mol. Its IUPAC name is 3-fluoro-4-(2-morpholin-4-ylethylsulfamoyl)benzoic acid.
| Compound Name | 3-fluoro-4-(2-morpholin-4-ylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 154741645 |
| Molecular Formula | C13H17FN2O5S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-fluoro-4-(2-morpholin-4-ylethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCCN2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C13H17FN2O5S/c14-11-9-10(13(17)18)1-2-12(11)22(19,20)15-3-4-16-5-7-21-8-6-16/h1-2,9,15H,3-8H2,(H,17,18) |
| InChIKey | YJQCARRYAYYPEV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |