C12H14FNO6S — CID 79177670
4-(1,4-dioxan-2-ylmethylsulfamoyl)-3-fluorobenzoic acid (PubChem CID 79177670) has the molecular formula C12H14FNO6S and a molecular weight of 319.31 g/mol. Its IUPAC name is 4-(1,4-dioxan-2-ylmethylsulfamoyl)-3-fluorobenzoic acid.
| Compound Name | 4-(1,4-dioxan-2-ylmethylsulfamoyl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 79177670 |
| Molecular Formula | C12H14FNO6S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 4-(1,4-dioxan-2-ylmethylsulfamoyl)-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCC2COCCO2)c(F)c1 |
| InChI | InChI=1S/C12H14FNO6S/c13-10-5-8(12(15)16)1-2-11(10)21(17,18)14-6-9-7-19-3-4-20-9/h1-2,5,9,14H,3-4,6-7H2,(H,15,16) |
| InChIKey | MTDNADNUFWBYAS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |