C11H14F2N2O4S — CID 107343258
3-amino-N-(1,4-dioxan-2-ylmethyl)-2,4-difluorobenzenesulfonamide (PubChem CID 107343258) has the molecular formula C11H14F2N2O4S and a molecular weight of 308.31 g/mol. Its IUPAC name is 3-amino-N-(1,4-dioxan-2-ylmethyl)-2,4-difluorobenzenesulfonamide.
| Compound Name | 3-amino-N-(1,4-dioxan-2-ylmethyl)-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107343258 |
| Molecular Formula | C11H14F2N2O4S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 3-amino-N-(1,4-dioxan-2-ylmethyl)-2,4-difluorobenzenesulfonamide |
| SMILES | Nc1c(F)ccc(S(=O)(=O)NCC2COCCO2)c1F |
| InChI | InChI=1S/C11H14F2N2O4S/c12-8-1-2-9(10(13)11(8)14)20(16,17)15-5-7-6-18-3-4-19-7/h1-2,7,15H,3-6,14H2 |
| InChIKey | KGXSYNSOPKOBIV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|