C12H18N2O5S — CID 61024620
5-amino-N-(1,4-dioxan-2-ylmethyl)-2-methoxybenzenesulfonamide (PubChem CID 61024620) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 5-amino-N-(1,4-dioxan-2-ylmethyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-N-(1,4-dioxan-2-ylmethyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 61024620 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-amino-N-(1,4-dioxan-2-ylmethyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(N)cc1S(=O)(=O)NCC1COCCO1 |
| InChI | InChI=1S/C12H18N2O5S/c1-17-11-3-2-9(13)6-12(11)20(15,16)14-7-10-8-18-4-5-19-10/h2-3,6,10,14H,4-5,7-8,13H2,1H3 |
| InChIKey | HXDWTIQPEKJXLA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|