C13H18F2N2O2S — CID 107343158
3-amino-N-(cyclohexylmethyl)-2,4-difluorobenzenesulfonamide (PubChem CID 107343158) has the molecular formula C13H18F2N2O2S and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-amino-N-(cyclohexylmethyl)-2,4-difluorobenzenesulfonamide.
| Compound Name | 3-amino-N-(cyclohexylmethyl)-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107343158 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-amino-N-(cyclohexylmethyl)-2,4-difluorobenzenesulfonamide |
| SMILES | Nc1c(F)ccc(S(=O)(=O)NCC2CCCCC2)c1F |
| InChI | InChI=1S/C13H18F2N2O2S/c14-10-6-7-11(12(15)13(10)16)20(18,19)17-8-9-4-2-1-3-5-9/h6-7,9,17H,1-5,8,16H2 |
| InChIKey | FSBSXJBOLUJHQT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|