C11H14F2N2O2S — CID 107343819
3-amino-2,4-difluoro-N-[(2-methylcyclopropyl)methyl]benzenesulfonamide (PubChem CID 107343819) has the molecular formula C11H14F2N2O2S and a molecular weight of 276.31 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-N-[(2-methylcyclopropyl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-2,4-difluoro-N-[(2-methylcyclopropyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107343819 |
| Molecular Formula | C11H14F2N2O2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-amino-2,4-difluoro-N-[(2-methylcyclopropyl)methyl]benzenesulfonamide |
| SMILES | CC1CC1CNS(=O)(=O)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C11H14F2N2O2S/c1-6-4-7(6)5-15-18(16,17)9-3-2-8(12)11(14)10(9)13/h2-3,6-7,15H,4-5,14H2,1H3 |
| InChIKey | XIZUJORJJHOIRT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|