C11H13BrFNO4S — CID 103697427
4-bromo-N-(1,4-dioxan-2-ylmethyl)-3-fluorobenzenesulfonamide (PubChem CID 103697427) has the molecular formula C11H13BrFNO4S and a molecular weight of 354.20 g/mol. Its IUPAC name is 4-bromo-N-(1,4-dioxan-2-ylmethyl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(1,4-dioxan-2-ylmethyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103697427 |
| Molecular Formula | C11H13BrFNO4S |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 4-bromo-N-(1,4-dioxan-2-ylmethyl)-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1COCCO1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C11H13BrFNO4S/c12-10-2-1-9(5-11(10)13)19(15,16)14-6-8-7-17-3-4-18-8/h1-2,5,8,14H,3-4,6-7H2 |
| InChIKey | AJKDHQLHEXWJOB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |