C17H25NO4S — CID 94606731
4-cyclohexyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]benzenesulfonamide (PubChem CID 94606731) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-cyclohexyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 94606731 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-cyclohexyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@H]1COCCO1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H25NO4S/c19-23(20,18-12-16-13-21-10-11-22-16)17-8-6-15(7-9-17)14-4-2-1-3-5-14/h6-9,14,16,18H,1-5,10-13H2/t16-/m0/s1 |
| InChIKey | GWTQQQGPHXFSAR-INIZCTEOSA-N |
| XLogP | 2.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |