C14H22N2O4S — CID 106016670
N-(1,4-dioxan-2-ylmethyl)-2-(ethylaminomethyl)benzenesulfonamide (PubChem CID 106016670) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-2-(ethylaminomethyl)benzenesulfonamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-2-(ethylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106016670 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-2-(ethylaminomethyl)benzenesulfonamide |
| SMILES | CCNCc1ccccc1S(=O)(=O)NCC1COCCO1 |
| InChI | InChI=1S/C14H22N2O4S/c1-2-15-9-12-5-3-4-6-14(12)21(17,18)16-10-13-11-19-7-8-20-13/h3-6,13,15-16H,2,7-11H2,1H3 |
| InChIKey | MRLLDPXYTNZHHI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |