C14H17NO5S — CID 61023978
N-(1,4-dioxan-2-ylmethyl)-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide (PubChem CID 61023978) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61023978 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1COCCO1)c1ccccc1C#CCO |
| InChI | InChI=1S/C14H17NO5S/c16-7-3-5-12-4-1-2-6-14(12)21(17,18)15-10-13-11-19-8-9-20-13/h1-2,4,6,13,15-16H,7-11H2 |
| InChIKey | WIKQZOXSJADKGQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|