C13H17NO3S — CID 60822753
N-butyl-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide (PubChem CID 60822753) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-butyl-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide.
| Compound Name | N-butyl-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60822753 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-butyl-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccccc1C#CCO |
| InChI | InChI=1S/C13H17NO3S/c1-2-3-10-14-18(16,17)13-9-5-4-7-12(13)8-6-11-15/h4-5,7,9,14-15H,2-3,10-11H2,1H3 |
| InChIKey | KXJQGAVSTBTODW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|