C11H14N2O5S2 — CID 60844580
2-(3-hydroxyprop-1-ynyl)-N-(2-sulfamoylethyl)benzenesulfonamide (PubChem CID 60844580) has the molecular formula C11H14N2O5S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(3-hydroxyprop-1-ynyl)-N-(2-sulfamoylethyl)benzenesulfonamide.
| Compound Name | 2-(3-hydroxyprop-1-ynyl)-N-(2-sulfamoylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60844580 |
| Molecular Formula | C11H14N2O5S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-(3-hydroxyprop-1-ynyl)-N-(2-sulfamoylethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)CCNS(=O)(=O)c1ccccc1C#CCO |
| InChI | InChI=1S/C11H14N2O5S2/c12-19(15,16)9-7-13-20(17,18)11-6-2-1-4-10(11)5-3-8-14/h1-2,4,6,13-14H,7-9H2,(H2,12,15,16) |
| InChIKey | YIKPWJGMHHQTSF-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|