C15H12FNO3S — CID 60823376
N-(4-fluorophenyl)-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide (PubChem CID 60823376) has the molecular formula C15H12FNO3S and a molecular weight of 305.33 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide.
| Compound Name | N-(4-fluorophenyl)-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60823376 |
| Molecular Formula | C15H12FNO3S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-(4-fluorophenyl)-2-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)cc1)c1ccccc1C#CCO |
| InChI | InChI=1S/C15H12FNO3S/c16-13-7-9-14(10-8-13)17-21(19,20)15-6-2-1-4-12(15)5-3-11-18/h1-2,4,6-10,17-18H,11H2 |
| InChIKey | CBLSOWPDTPLPCZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|