C13H10FN3O3S — CID 60844745
4-fluoro-2-(3-hydroxyprop-1-ynyl)-N-pyrimidin-2-ylbenzenesulfonamide (PubChem CID 60844745) has the molecular formula C13H10FN3O3S and a molecular weight of 307.31 g/mol. Its IUPAC name is 4-fluoro-2-(3-hydroxyprop-1-ynyl)-N-pyrimidin-2-ylbenzenesulfonamide.
| Compound Name | 4-fluoro-2-(3-hydroxyprop-1-ynyl)-N-pyrimidin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 60844745 |
| Molecular Formula | C13H10FN3O3S |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-fluoro-2-(3-hydroxyprop-1-ynyl)-N-pyrimidin-2-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncccn1)c1ccc(F)cc1C#CCO |
| InChI | InChI=1S/C13H10FN3O3S/c14-11-4-5-12(10(9-11)3-1-8-18)21(19,20)17-13-15-6-2-7-16-13/h2,4-7,9,18H,8H2,(H,15,16,17) |
| InChIKey | PTNYMFDCQQKDGE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|