C12H12FNO5S — CID 60824282
methyl 2-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]acetate (PubChem CID 60824282) has the molecular formula C12H12FNO5S and a molecular weight of 301.30 g/mol. Its IUPAC name is methyl 2-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]acetate.
| Compound Name | methyl 2-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 60824282 |
| Molecular Formula | C12H12FNO5S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | methyl 2-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]acetate |
| SMILES | COC(=O)CNS(=O)(=O)c1ccc(F)cc1C#CCO |
| InChI | InChI=1S/C12H12FNO5S/c1-19-12(16)8-14-20(17,18)11-5-4-10(13)7-9(11)3-2-6-15/h4-5,7,14-15H,6,8H2,1H3 |
| InChIKey | CBXYSEHLEAYYSS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|