C11H12FN3O3S — CID 60843766
2-[[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]sulfonylamino]acetamide (PubChem CID 60843766) has the molecular formula C11H12FN3O3S and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]sulfonylamino]acetamide.
| Compound Name | 2-[[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 60843766 |
| Molecular Formula | C11H12FN3O3S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]sulfonylamino]acetamide |
| SMILES | NCC#Cc1cc(F)ccc1S(=O)(=O)NCC(N)=O |
| InChI | InChI=1S/C11H12FN3O3S/c12-9-3-4-10(8(6-9)2-1-5-13)19(17,18)15-7-11(14)16/h3-4,6,15H,5,7,13H2,(H2,14,16) |
| InChIKey | UDXFYKICVQLPBQ-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|