C14H19FN2O2S — CID 61167092
2-(3-aminoprop-1-ynyl)-N-(2,2-dimethylpropyl)-4-fluorobenzenesulfonamide (PubChem CID 61167092) has the molecular formula C14H19FN2O2S and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-N-(2,2-dimethylpropyl)-4-fluorobenzenesulfonamide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-N-(2,2-dimethylpropyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61167092 |
| Molecular Formula | C14H19FN2O2S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-N-(2,2-dimethylpropyl)-4-fluorobenzenesulfonamide |
| SMILES | CC(C)(C)CNS(=O)(=O)c1ccc(F)cc1C#CCN |
| InChI | InChI=1S/C14H19FN2O2S/c1-14(2,3)10-17-20(18,19)13-7-6-12(15)9-11(13)5-4-8-16/h6-7,9,17H,8,10,16H2,1-3H3 |
| InChIKey | BRWOYTNQWBPAMD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|