C11H10F4N2O2S — CID 116529303
4-(3-aminoprop-1-ynyl)-2-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 116529303) has the molecular formula C11H10F4N2O2S and a molecular weight of 310.27 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-2-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-2-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 116529303 |
| Molecular Formula | C11H10F4N2O2S |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-2-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | NCC#Cc1ccc(S(=O)(=O)NCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H10F4N2O2S/c12-9-6-8(2-1-5-16)3-4-10(9)20(18,19)17-7-11(13,14)15/h3-4,6,17H,5,7,16H2 |
| InChIKey | NQYMVUPQRPOJSN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|