C12H11FN4O2S2 — CID 116529690
4-(3-aminoprop-1-ynyl)-2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 116529690) has the molecular formula C12H11FN4O2S2 and a molecular weight of 326.38 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 116529690 |
| Molecular Formula | C12H11FN4O2S2 |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | Cc1nsc(NS(=O)(=O)c2ccc(C#CCN)cc2F)n1 |
| InChI | InChI=1S/C12H11FN4O2S2/c1-8-15-12(20-16-8)17-21(18,19)11-5-4-9(3-2-6-14)7-10(11)13/h4-5,7H,6,14H2,1H3,(H,15,16,17) |
| InChIKey | JZGGNDFAJXKBHP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|