C15H21FN2O2S — CID 103464034
4-(3-aminoprop-1-ynyl)-N-(2,2-dimethylbutyl)-2-fluorobenzenesulfonamide (PubChem CID 103464034) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-N-(2,2-dimethylbutyl)-2-fluorobenzenesulfonamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-N-(2,2-dimethylbutyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103464034 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-N-(2,2-dimethylbutyl)-2-fluorobenzenesulfonamide |
| SMILES | CCC(C)(C)CNS(=O)(=O)c1ccc(C#CCN)cc1F |
| InChI | InChI=1S/C15H21FN2O2S/c1-4-15(2,3)11-18-21(19,20)14-8-7-12(6-5-9-17)10-13(14)16/h7-8,10,18H,4,9,11,17H2,1-3H3 |
| InChIKey | ICBWJDXLSKYFEQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|