C14H19FN2O3S — CID 61447521
2-(3-aminoprop-1-ynyl)-N-ethyl-4-fluoro-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 61447521) has the molecular formula C14H19FN2O3S and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-N-ethyl-4-fluoro-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-N-ethyl-4-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61447521 |
| Molecular Formula | C14H19FN2O3S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-N-ethyl-4-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | CCN(CCOC)S(=O)(=O)c1ccc(F)cc1C#CCN |
| InChI | InChI=1S/C14H19FN2O3S/c1-3-17(9-10-20-2)21(18,19)14-7-6-13(15)11-12(14)5-4-8-16/h6-7,11H,3,8-10,16H2,1-2H3 |
| InChIKey | NGFYFWOGQKCQCX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|