C11H17FN2O5S2 — CID 61384433
1-N-ethyl-2-fluoro-1-N-(2-methoxyethyl)benzene-1,4-disulfonamide (PubChem CID 61384433) has the molecular formula C11H17FN2O5S2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-N-ethyl-2-fluoro-1-N-(2-methoxyethyl)benzene-1,4-disulfonamide.
| Compound Name | 1-N-ethyl-2-fluoro-1-N-(2-methoxyethyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 61384433 |
| Molecular Formula | C11H17FN2O5S2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-N-ethyl-2-fluoro-1-N-(2-methoxyethyl)benzene-1,4-disulfonamide |
| SMILES | CCN(CCOC)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C11H17FN2O5S2/c1-3-14(6-7-19-2)21(17,18)11-5-4-9(8-10(11)12)20(13,15)16/h4-5,8H,3,6-7H2,1-2H3,(H2,13,15,16) |
| InChIKey | YHCXDBUFDCFZCD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |