C10H13FN2O4S2 — CID 47358758
1-N-cyclopropyl-2-fluoro-1-N-methylbenzene-1,4-disulfonamide (PubChem CID 47358758) has the molecular formula C10H13FN2O4S2 and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-N-cyclopropyl-2-fluoro-1-N-methylbenzene-1,4-disulfonamide.
| Compound Name | 1-N-cyclopropyl-2-fluoro-1-N-methylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 47358758 |
| Molecular Formula | C10H13FN2O4S2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 1-N-cyclopropyl-2-fluoro-1-N-methylbenzene-1,4-disulfonamide |
| SMILES | CN(C1CC1)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C10H13FN2O4S2/c1-13(7-2-3-7)19(16,17)10-5-4-8(6-9(10)11)18(12,14)15/h4-7H,2-3H2,1H3,(H2,12,14,15) |
| InChIKey | OCDRSQRDHZGRGB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |