C13H19FN2O2S — CID 79187108
N-cyclopropyl-4-(ethylaminomethyl)-2-fluoro-N-methylbenzenesulfonamide (PubChem CID 79187108) has the molecular formula C13H19FN2O2S and a molecular weight of 286.37 g/mol. Its IUPAC name is N-cyclopropyl-4-(ethylaminomethyl)-2-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-cyclopropyl-4-(ethylaminomethyl)-2-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79187108 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-cyclopropyl-4-(ethylaminomethyl)-2-fluoro-N-methylbenzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)N(C)C2CC2)c(F)c1 |
| InChI | InChI=1S/C13H19FN2O2S/c1-3-15-9-10-4-7-13(12(14)8-10)19(17,18)16(2)11-5-6-11/h4,7-8,11,15H,3,5-6,9H2,1-2H3 |
| InChIKey | FZDFPRROGRXQRP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |