C13H19FN2O2S — CID 79190650
N-(cyclopropylmethyl)-4-(ethylaminomethyl)-2-fluorobenzenesulfonamide (PubChem CID 79190650) has the molecular formula C13H19FN2O2S and a molecular weight of 286.37 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-(ethylaminomethyl)-2-fluorobenzenesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-4-(ethylaminomethyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 79190650 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-(cyclopropylmethyl)-4-(ethylaminomethyl)-2-fluorobenzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NCC2CC2)c(F)c1 |
| InChI | InChI=1S/C13H19FN2O2S/c1-2-15-8-11-5-6-13(12(14)7-11)19(17,18)16-9-10-3-4-10/h5-7,10,15-16H,2-4,8-9H2,1H3 |
| InChIKey | PRAKQUBAINEPHR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |