C14H23FN2O3S — CID 106080734
4-(ethylaminomethyl)-2-fluoro-N-(1-methoxy-2-methylpropan-2-yl)benzenesulfonamide (PubChem CID 106080734) has the molecular formula C14H23FN2O3S and a molecular weight of 318.41 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-2-fluoro-N-(1-methoxy-2-methylpropan-2-yl)benzenesulfonamide.
| Compound Name | 4-(ethylaminomethyl)-2-fluoro-N-(1-methoxy-2-methylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106080734 |
| Molecular Formula | C14H23FN2O3S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-(ethylaminomethyl)-2-fluoro-N-(1-methoxy-2-methylpropan-2-yl)benzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NC(C)(C)COC)c(F)c1 |
| InChI | InChI=1S/C14H23FN2O3S/c1-5-16-9-11-6-7-13(12(15)8-11)21(18,19)17-14(2,3)10-20-4/h6-8,16-17H,5,9-10H2,1-4H3 |
| InChIKey | SLRKBGYZUKCUAT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |