C13H23N3O3S — CID 106080557
5-(ethylaminomethyl)-N-(1-methoxy-2-methylpropan-2-yl)pyridine-2-sulfonamide (PubChem CID 106080557) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-(1-methoxy-2-methylpropan-2-yl)pyridine-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-(1-methoxy-2-methylpropan-2-yl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 106080557 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 5-(ethylaminomethyl)-N-(1-methoxy-2-methylpropan-2-yl)pyridine-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NC(C)(C)COC)nc1 |
| InChI | InChI=1S/C13H23N3O3S/c1-5-14-8-11-6-7-12(15-9-11)20(17,18)16-13(2,3)10-19-4/h6-7,9,14,16H,5,8,10H2,1-4H3 |
| InChIKey | VKJKJCGGWDEOEK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |