C10H15N7O2S — CID 106051487
5-(ethylaminomethyl)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-sulfonamide (PubChem CID 106051487) has the molecular formula C10H15N7O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 106051487 |
| Molecular Formula | C10H15N7O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-(ethylaminomethyl)-N-(2H-tetrazol-5-ylmethyl)pyridine-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NCc2nn[nH]n2)nc1 |
| InChI | InChI=1S/C10H15N7O2S/c1-2-11-5-8-3-4-10(12-6-8)20(18,19)13-7-9-14-16-17-15-9/h3-4,6,11,13H,2,5,7H2,1H3,(H,14,15,16,17) |
| InChIKey | UPDAVPCBZODIQK-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |