C9H12N6O — CID 114936716
1-(6-methoxy-3-pyridinyl)-N-(2H-tetrazol-5-ylmethyl)methanamine (PubChem CID 114936716) has the molecular formula C9H12N6O and a molecular weight of 220.24 g/mol. Its IUPAC name is 1-(6-methoxy-3-pyridinyl)-N-(2H-tetrazol-5-ylmethyl)methanamine.
| Compound Name | 1-(6-methoxy-3-pyridinyl)-N-(2H-tetrazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 114936716 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-(6-methoxy-3-pyridinyl)-N-(2H-tetrazol-5-ylmethyl)methanamine |
| SMILES | COc1ccc(CNCc2nn[nH]n2)cn1 |
| InChI | InChI=1S/C9H12N6O/c1-16-9-3-2-7(5-11-9)4-10-6-8-12-14-15-13-8/h2-3,5,10H,4,6H2,1H3,(H,12,13,14,15) |
| InChIKey | HEGXYMYNXYVQQW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |