C11H18N4O2 — CID 77032726
N'-hydroxy-3-[(6-methoxy-3-pyridinyl)methylamino]-2-methylpropanimidamide (PubChem CID 77032726) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is N'-hydroxy-3-[(6-methoxy-3-pyridinyl)methylamino]-2-methylpropanimidamide.
| Compound Name | N'-hydroxy-3-[(6-methoxy-3-pyridinyl)methylamino]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 77032726 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | N'-hydroxy-3-[(6-methoxy-3-pyridinyl)methylamino]-2-methylpropanimidamide |
| SMILES | COc1ccc(CNCC(C)C(N)=NO)cn1 |
| InChI | InChI=1S/C11H18N4O2/c1-8(11(12)15-16)5-13-6-9-3-4-10(17-2)14-7-9/h3-4,7-8,13,16H,5-6H2,1-2H3,(H2,12,15) |
| InChIKey | ACAKPBZZDZMUKR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|