C14H24N2O3 — CID 62991515
1-[(6-methoxy-3-pyridinyl)methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol (PubChem CID 62991515) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[(6-methoxy-3-pyridinyl)methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol.
| Compound Name | 1-[(6-methoxy-3-pyridinyl)methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 62991515 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[(6-methoxy-3-pyridinyl)methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
| SMILES | COc1ccc(CNCC(O)COC(C)(C)C)cn1 |
| InChI | InChI=1S/C14H24N2O3/c1-14(2,3)19-10-12(17)9-15-7-11-5-6-13(18-4)16-8-11/h5-6,8,12,15,17H,7,9-10H2,1-4H3 |
| InChIKey | WBBTWSPUYCREAF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |