C14H23N3O3 — CID 62991338
1-[(6-methoxy-3-pyridinyl)methylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 62991338) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-[(6-methoxy-3-pyridinyl)methylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[(6-methoxy-3-pyridinyl)methylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 62991338 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-[(6-methoxy-3-pyridinyl)methylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | COc1ccc(CNCC(O)CN2CCOCC2)cn1 |
| InChI | InChI=1S/C14H23N3O3/c1-19-14-3-2-12(9-16-14)8-15-10-13(18)11-17-4-6-20-7-5-17/h2-3,9,13,15,18H,4-8,10-11H2,1H3 |
| InChIKey | WSDYULUIWQNBGP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |