C17H23N2O4P — CID 68889920
benzyl-[(2R)-2-hydroxy-3-[(6-methoxy-3-pyridinyl)methylamino]propyl]phosphinic acid (PubChem CID 68889920) has the molecular formula C17H23N2O4P and a molecular weight of 350.36 g/mol. Its IUPAC name is benzyl-[(2R)-2-hydroxy-3-[(6-methoxy-3-pyridinyl)methylamino]propyl]phosphinic acid.
| Compound Name | benzyl-[(2R)-2-hydroxy-3-[(6-methoxy-3-pyridinyl)methylamino]propyl]phosphinic acid |
|---|---|
| PubChem CID | 68889920 |
| Molecular Formula | C17H23N2O4P |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | benzyl-[(2R)-2-hydroxy-3-[(6-methoxy-3-pyridinyl)methylamino]propyl]phosphinic acid |
| SMILES | COc1ccc(CNC[C@@H](O)CP(=O)(O)Cc2ccccc2)cn1 |
| InChI | InChI=1S/C17H23N2O4P/c1-23-17-8-7-15(10-19-17)9-18-11-16(20)13-24(21,22)12-14-5-3-2-4-6-14/h2-8,10,16,18,20H,9,11-13H2,1H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | UHOICZNZGOUGJD-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|