C16H21N2O3P — CID 67791611
benzyl-[(2R)-2-hydroxy-3-(pyridin-2-ylmethylamino)propyl]phosphinic acid (PubChem CID 67791611) has the molecular formula C16H21N2O3P and a molecular weight of 320.33 g/mol. Its IUPAC name is benzyl-[(2R)-2-hydroxy-3-(pyridin-2-ylmethylamino)propyl]phosphinic acid.
| Compound Name | benzyl-[(2R)-2-hydroxy-3-(pyridin-2-ylmethylamino)propyl]phosphinic acid |
|---|---|
| PubChem CID | 67791611 |
| Molecular Formula | C16H21N2O3P |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | benzyl-[(2R)-2-hydroxy-3-(pyridin-2-ylmethylamino)propyl]phosphinic acid |
| SMILES | O=P(O)(Cc1ccccc1)C[C@H](O)CNCc1ccccn1 |
| InChI | InChI=1S/C16H21N2O3P/c19-16(11-17-10-15-8-4-5-9-18-15)13-22(20,21)12-14-6-2-1-3-7-14/h1-9,16-17,19H,10-13H2,(H,20,21)/t16-/m1/s1 |
| InChIKey | DQTXREZQTSRRTI-MRXNPFEDSA-N |
| XLogP | 2.00 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|