C12H20N2O — CID 115644639
4-methyl-5-(pyridin-2-ylmethylamino)pentan-2-ol (PubChem CID 115644639) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-methyl-5-(pyridin-2-ylmethylamino)pentan-2-ol.
| Compound Name | 4-methyl-5-(pyridin-2-ylmethylamino)pentan-2-ol |
|---|---|
| PubChem CID | 115644639 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-methyl-5-(pyridin-2-ylmethylamino)pentan-2-ol |
| SMILES | CC(O)CC(C)CNCc1ccccn1 |
| InChI | InChI=1S/C12H20N2O/c1-10(7-11(2)15)8-13-9-12-5-3-4-6-14-12/h3-6,10-11,13,15H,7-9H2,1-2H3 |
| InChIKey | TXFPJPGAOBPTGC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |