C12H20N2O5 — CID 22797314
(2R,3R,4R,5S)-6-(pyridin-2-ylmethylamino)hexane-1,2,3,4,5-pentol (PubChem CID 22797314) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(pyridin-2-ylmethylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-(pyridin-2-ylmethylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 22797314 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2R,3R,4R,5S)-6-(pyridin-2-ylmethylamino)hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CNCc1ccccn1 |
| InChI | InChI=1S/C12H20N2O5/c15-7-10(17)12(19)11(18)9(16)6-13-5-8-3-1-2-4-14-8/h1-4,9-13,15-19H,5-7H2/t9-,10+,11+,12+/m0/s1 |
| InChIKey | SFHFROJFLVFZKR-IRCOFANPSA-N |
| XLogP | -2.39 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |