C10H17ClN2 — CID 17332283
2-methyl-N-(pyridin-2-ylmethyl)propan-1-amine;hydrochloride (PubChem CID 17332283) has the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. Its IUPAC name is 2-methyl-N-(pyridin-2-ylmethyl)propan-1-amine;hydrochloride.
| Compound Name | 2-methyl-N-(pyridin-2-ylmethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17332283 |
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 2-methyl-N-(pyridin-2-ylmethyl)propan-1-amine;hydrochloride |
| SMILES | CC(C)CNCc1ccccn1.Cl |
| InChI | InChI=1S/C10H16N2.ClH/c1-9(2)7-11-8-10-5-3-4-6-12-10;/h3-6,9,11H,7-8H2,1-2H3;1H |
| InChIKey | JSLMFGLUOGFZDW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |