C10H16N2O2 — CID 61149855
(2S)-3-(2-pyridin-2-ylethylamino)propane-1,2-diol (PubChem CID 61149855) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2S)-3-(2-pyridin-2-ylethylamino)propane-1,2-diol.
| Compound Name | (2S)-3-(2-pyridin-2-ylethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 61149855 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (2S)-3-(2-pyridin-2-ylethylamino)propane-1,2-diol |
| SMILES | OC[C@@H](O)CNCCc1ccccn1 |
| InChI | InChI=1S/C10H16N2O2/c13-8-10(14)7-11-6-4-9-3-1-2-5-12-9/h1-3,5,10-11,13-14H,4,6-8H2/t10-/m0/s1 |
| InChIKey | BHYOLUHRPZDCRK-JTQLQIEISA-N |
| XLogP | -0.43 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|