C10H17N3 — CID 115196859
1-N-(2-pyridin-2-ylethyl)propane-1,2-diamine (PubChem CID 115196859) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-N-(2-pyridin-2-ylethyl)propane-1,2-diamine.
| Compound Name | 1-N-(2-pyridin-2-ylethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115196859 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-N-(2-pyridin-2-ylethyl)propane-1,2-diamine |
| SMILES | CC(N)CNCCc1ccccn1 |
| InChI | InChI=1S/C10H17N3/c1-9(11)8-12-7-5-10-4-2-3-6-13-10/h2-4,6,9,12H,5,7-8,11H2,1H3 |
| InChIKey | QKOQSCDBXXHIFV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|